Name:  ________________________
		Worksheet #9 Quarter 4 Packet 5
			Amines and Amides
	1.   Name the compound CH3(CH2)6NH2 2.   Name the compound CH3CH2CH(NH2)(CH2)4CH3 3.   Name the compound CH3(CH2)3CH(NH2)(CH2)4CH3 4.   Name the compound CH3CH(NH2)CH2CH3 5.   Name the compound CH3(CH2)6NH2 6.   Write the condensed structuralformula for 3-pentanamine 7.   Write the condensed structaral formula for methanamine 8.   Write the condensed structural formula for 4- octanamine 9.   Write the condensed structural formula for nonanamine 10. Write the condensed structural formula for 3-decanamine 11. Name the amide CH3CH2CONH2 12. Name the amide CH3(CH2)7CONH2 13. Name the amide CHONH2 14. Name the amide CH3(CH2)6CONH2 15. Name the amide CH3CH(CH3)CH2CH2CONH2 16. Write the condensed structural formula for nonanamide 17. Write the condensed structural formula for 2-methylbutanamide 18. Write the condensed structural formula for octanamide 19. Write the condensed structural formula for decanamide 20. Write the condensed structusal formula for 2-methylhexanamide