1. Name the Carboxylic acid with the following condensed structrual fomula:
CH3(CH2)5COOH
2. Write the condensed structural formula for decanoic acid
3. What is the name of the ester derived
from the reaction between ethanol and butanoic acid?
4. Name the Carboxylic acid with following condensed stuctural formula:
CH3CH2CH(CH3)(CH2)COOH
5. What is the name of the ester derived from the reaction between propanol and
pentanoic acid?
6. Name the Carboxylic acid with the following consensed structural formula:
CH3(CH2)2CH(CH3)(CH2)3COOH
7. What is the name of the ester derived from the reaction between methanol and ethanoic acid?
8. Write the condensed structural formula for propanoic acid.
9. What is the name of the ester derived from the reaction between ethanol and octanoic acid?
10. Write the condensed structural formula for octanoic acid.
11. Write a condensed stuctural formula for butyl propanoate.
12. Name the Carbonxylic acid with the condensed structural formula:
CH3CH(CH3)COOH
13. What is the name of the ester derived from the reaction between methanol and methanoic acid?
14. Name the Carbonxylic acid with the conednsed stuctural formula:
CH3(CH2)3COOH
15. Write a conensed structural formula for propylbutanoate.
16. What is the name of the ester derived
from the reaction between ethanol and propanoic acid?
17. Write the condensed sturctural formula for nonanoic acid.
18. What is the name of the ester derived
from the reaction between methanol and
heptanoic acid?
19. Give the IUPAC name for lactic acid, which has the condensed structural formula CH3CH(OH)COOH (Hint Use the prefix hydroxy- for the hydroxyl group)
20. What is the name of the ester derived from the reaction between butanol and pentanoic acid?