Name_______________________________ Date_______________________ Class__________
Esters
1.Name the carboxylic acid with the
Following condensed structural formula:
CH3(CH2)5COOH
2. Name the carboxylic acid with the
Following condensed structural formula:
CH3CH2CH(CH3)(CH2)2COOH
3.Name the carboxylic acid with the
following condensed structural formula: CH3(CH2)2CH(CH3)(CH2)3COOH
4. Write the structural formula for
propanoic acid.
5. Write the structural formula for octanoic acid
6.Name the carboxylic acid with the
following condensed structural formula:
CH3CH(CH3)COOH
7. Name the carboxylic acid with the
following condensed structural formula:
CH3(CH2)3COOH
8. Write the structural formula
for nonanoic acid
9. Write the structural formula for ethanol.
10. Write the structural formula for
decanoic acid.
11. What is the name for the ester derived
from the reaction between ethanol and
butanoic acid? Write its structural formula.
12. What is the name for the ester derive from
the reaction between propanol and
pentanoic acid? Write its structural formula.
13. What is the name of the ester derived from
the reaction between methanol and
ethanoic acid? Write its structural formula.
14. What is the name of the ester derived from
the reaction between ethanol and octanoic
acid? Write its structural formula.
15. Write a structural formula for
butyl propanoate.
16. What is the name of the ester derived from
the reaction between methanol and
methanoic acid? Write its structural formula.
17. Write the structural formula for propyl butanoate.
18.What is the name of the ester derived from the reaction between ethanol and
propanoic acid? Write its structural formula.
19. What is the name of the ester derived from the reaction between methanol and heptanoic acid? Write its structural formula.
20. What is the name of the ester derived from the reaction between butanol and
Pentanoic acid? Write its structural formula.