Name______________ Day________________

Date_______________

Impact of Science Take-home Quiz 2

  1. How many carbon atoms does a molecule of propane contain?
  2. If I drink propyl alcohol, will it make me sick?

    ___ yes ___ no

  3. Look at the following molecule:
  4. CH3-(CH2)4-CH=CH-CH2-CH=C=CH-(CH2)5-COOH

    Is this molecule ___ saturated or ___ unsaturated ?

    Is this molecule more likely to be ___ solid or ___ liquid at room temperature?

  5. What is the main difference between beer and wine?
  6.  

     

  7. Some friends have taken up home brewing as a hobby. They have just made a batch of brandy. You ask them how they made it, and they say that they simply fermented their grapes, added flavoring, then distilled the entire batch. You ask: "did you throw any part of the batch away?" "No," they reply." "We just did what Great Uncle Earnie used to do—we distilled everything and kept the entire run.

Should you drink their brandy? Why or why not?

 

 

6. Can humans digest cellulose? ___ yes ___ no

 

  1. What is the difference between a monosaccharide and a disaccharide?
  2.  

     

  3. What two primary functions does fat play in our bodies?

 

 

9. How many essential amino acids are there for human adults? How many for human children?

 

 

10. What are these amino acids used to make in our bodies?